4-N,4-N,5-N,5-N-tetramethyl-2-phenyl-1,3-oxazole-4,5-dicarboxamide structure
|
Common Name | 4-N,4-N,5-N,5-N-tetramethyl-2-phenyl-1,3-oxazole-4,5-dicarboxamide | ||
|---|---|---|---|---|
| CAS Number | 42469-80-7 | Molecular Weight | 287.31400 | |
| Density | 1.19g/cm3 | Boiling Point | 520.6ºC at 760 mmHg | |
| Molecular Formula | C15H17N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.6ºC | |
| Name | 4-N,4-N,5-N,5-N-tetramethyl-2-phenyl-1,3-oxazole-4,5-dicarboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 520.6ºC at 760 mmHg |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.31400 |
| Flash Point | 268.6ºC |
| Exact Mass | 287.12700 |
| PSA | 66.65000 |
| LogP | 1.74520 |
| Index of Refraction | 1.559 |
| InChIKey | AFSHYUMTZPNZFM-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)c1nc(-c2ccccc2)oc1C(=O)N(C)C |
| HS Code | 2934999090 |
|---|
|
~%
4-N,4-N,5-N,5-N... CAS#:42469-80-7 |
| Literature: Tarzia,G. et al. European Journal of Medicinal Chemistry, 1976 , vol. 11, p. 263 - 270 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Phenyl-N,N,N',N'-tetramethyloxazole-4,5-dicarboxamide |
| 2-phenyl-oxazole-4,5-dicarboxylic acid bis-dimethylamide |
| Oxazole-4,5-dicarboxamide,2-phenyl-N,N,N',N'-tetramethyl |