1-(4-Ethenyl-1-bicyclo[2.2.1]heptanyl)-2,2,2-trifluoroethanone
Modify Date: 2026-07-07 17:29:31
![1-(4-Ethenyl-1-bicyclo[2.2.1]heptanyl)-2,2,2-trifluoroethanone Structure](https://www.chemsrc.com/extcaspic/273/424826-94-8.png)
1-(4-Ethenyl-1-bicyclo[2.2.1]heptanyl)-2,2,2-trifluoroethanone structure
|
Common Name | 1-(4-Ethenyl-1-bicyclo[2.2.1]heptanyl)-2,2,2-trifluoroethanone | ||
|---|---|---|---|---|
| CAS Number | 424826-94-8 | Molecular Weight | 218.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-Ethenyl-1-bicyclo[2.2.1]heptanyl)-2,2,2-trifluoroethanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H13F3O |
|---|---|
| Molecular Weight | 218.21 |
| InChIKey | GUEYPDBEPVIPRO-UHFFFAOYSA-N |
| SMILES | C=CC12CCC(C(=O)C(F)(F)F)(CC1)C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-(4-Ethenyl-1-bicyclo[2.2.1]heptanyl)-2,2,2-trifluoroethanone? |
| A: Molecular weight of 1-(4-Ethenyl-1-bicyclo[2.2.1]heptanyl)-2,2,2-trifluoroethanone is 218.21. |
| Q: What is the InChIKey of 1-(4-Ethenyl-1-bicyclo[2.2.1]heptanyl)-2,2,2-trifluoroethanone? |
| A: InChIKey of 1-(4-Ethenyl-1-bicyclo[2.2.1]heptanyl)-2,2,2-trifluoroethanone is GUEYPDBEPVIPRO-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-(4-Ethenyl-1-bicyclo[2.2.1]heptanyl)-2,2,2-trifluoroethanone? |
| A: CAS number of 1-(4-Ethenyl-1-bicyclo[2.2.1]heptanyl)-2,2,2-trifluoroethanone is 424826-94-8. |
| Q: What is the molecular formula of 1-(4-Ethenyl-1-bicyclo[2.2.1]heptanyl)-2,2,2-trifluoroethanone? |
| A: Molecular formula of 1-(4-Ethenyl-1-bicyclo[2.2.1]heptanyl)-2,2,2-trifluoroethanone is C11H13F3O. |
| Q: What is the English name of 1-(4-Ethenyl-1-bicyclo[2.2.1]heptanyl)-2,2,2-trifluoroethanone? |
| A: The English name of 1-(4-Ethenyl-1-bicyclo[2.2.1]heptanyl)-2,2,2-trifluoroethanone is 1-(4-Ethenyl-1-bicyclo[2.2.1]heptanyl)-2,2,2-trifluoroethanone. |
| Q: What is the Chinese name of 424826-94-8? |
| A: Chinese name of 424826-94-8 is 424826-94-8. |
| Q: What is the SMILES notation of 1-(4-Ethenyl-1-bicyclo[2.2.1]heptanyl)-2,2,2-trifluoroethanone? |
| A: SMILES notation of 1-(4-Ethenyl-1-bicyclo[2.2.1]heptanyl)-2,2,2-trifluoroethanone is C=CC12CCC(C(=O)C(F)(F)F)(CC1)C2. |