2-(diethylamino)-6-methyl-1H-pyrimidin-4-one structure
|
Common Name | 2-(diethylamino)-6-methyl-1H-pyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 42487-72-9 | Molecular Weight | 181.23500 | |
| Density | 1.1g/cm3 | Boiling Point | 266ºC at 760mmHg | |
| Molecular Formula | C9H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 114.7ºC | |
| Name | 2-diethylamino-6-methylpyrimidin-4(1H)-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 266ºC at 760mmHg |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.23500 |
| Flash Point | 114.7ºC |
| Exact Mass | 181.12200 |
| PSA | 49.25000 |
| LogP | 1.33680 |
| Index of Refraction | 1.545 |
| InChIKey | NQCPECCCWDWTJJ-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1nc(C)cc(=O)[nH]1 |
| HS Code | 2933599090 |
|---|
|
~80%
2-(diethylamino... CAS#:42487-72-9 |
| Literature: Gershon; Grefig; Clarke Journal of Heterocyclic Chemistry, 1987 , vol. 24, # 1 p. 205 - 209 |
|
~%
2-(diethylamino... CAS#:42487-72-9 |
| Literature: Gershon; Grefig; Clarke Journal of Heterocyclic Chemistry, 1987 , vol. 24, # 1 p. 205 - 209 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(diethylamino)-6-methyl-1H-pyrimidin-4-one |
| 2-diethylamino-4-hydroxy-6-methyl-pyrimidine |
| 2-diethylamino-6-methyl-3H-pyrimidin-4-one |
| EINECS 255-848-6 |
| 2-diethylamino-6-methylpyrimidin-4-ol |
| 2-Diethylamino-6-hydroxy-4-methylpyrimidine |