(2-methoxyphenyl)-(4-nitrophenyl)methanone structure
|
Common Name | (2-methoxyphenyl)-(4-nitrophenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 42495-50-1 | Molecular Weight | 257.24100 | |
| Density | 1.264g/cm3 | Boiling Point | 454.1ºC at 760 mmHg | |
| Molecular Formula | C14H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.4ºC | |
| Name | (2-methoxyphenyl)-(4-nitrophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.264g/cm3 |
|---|---|
| Boiling Point | 454.1ºC at 760 mmHg |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.24100 |
| Flash Point | 209.4ºC |
| Exact Mass | 257.06900 |
| PSA | 72.12000 |
| LogP | 3.35760 |
| Index of Refraction | 1.596 |
| InChIKey | DHMLRUWJBJQWFC-UHFFFAOYSA-N |
| SMILES | COc1ccccc1C(=O)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-METHOXY-4'-NITROBENZOPHENONE |
| Methanone,(2-methoxyphenyl)(4-nitrophenyl) |
| 2-Methoxy-4'-nitro-benzophenon |
| 2-methoxyphenyl(4-nitrophenyl)methanone |