2,3,4,9-tetrahydro-1h-carbazole-1-carboxylic acid structure
|
Common Name | 2,3,4,9-tetrahydro-1h-carbazole-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 42497-46-1 | Molecular Weight | 215.24800 | |
| Density | 1.337g/cm3 | Boiling Point | 466.4ºC at 760 mmHg | |
| Molecular Formula | C13H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.8ºC | |
| Name | 2,3,4,9-tetrahydro-1h-carbazole-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.337g/cm3 |
|---|---|
| Boiling Point | 466.4ºC at 760 mmHg |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.24800 |
| Flash Point | 235.8ºC |
| Exact Mass | 215.09500 |
| PSA | 53.09000 |
| LogP | 2.67240 |
| Index of Refraction | 1.688 |
| InChIKey | QFLIXPBSNSYURJ-UHFFFAOYSA-N |
| SMILES | O=C(O)C1CCCc2c1[nH]c1ccccc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,2,3,4-tetrahydro-carbazole-1-carboxylic acid |
| 2,3,4,3',4',5'-HEXAHYDROXYBENZOPHENONE |
| 1,2,3,4,9-pentahydro-4aH-carbazolecarboxylic acid |