tert-Butyl heptafluorobutanoate
Modify Date: 2026-07-08 18:44:15
tert-Butyl heptafluorobutanoate structure
|
Common Name | tert-Butyl heptafluorobutanoate | ||
|---|---|---|---|---|
| CAS Number | 425-24-1 | Molecular Weight | 270.14 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9F7O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-Butyl heptafluorobutanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H9F7O2 |
|---|---|
| Molecular Weight | 270.14 |
| InChIKey | JPVACFHILHDRGX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(F)(F)C(F)(F)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of tert-Butyl heptafluorobutanoate? |
| A: Molecular weight of tert-Butyl heptafluorobutanoate is 270.14. |
| Q: What is the molecular formula of tert-Butyl heptafluorobutanoate? |
| A: Molecular formula of tert-Butyl heptafluorobutanoate is C8H9F7O2. |
| Q: What is the SMILES notation of tert-Butyl heptafluorobutanoate? |
| A: SMILES notation of tert-Butyl heptafluorobutanoate is CC(C)(C)OC(=O)C(F)(F)C(F)(F)C(F)(F)F. |
| Q: What is the Chinese name of 425-24-1? |
| A: Chinese name of 425-24-1 is 425-24-1. |
| Q: What is the English name of tert-Butyl heptafluorobutanoate? |
| A: The English name of tert-Butyl heptafluorobutanoate is tert-Butyl heptafluorobutanoate. |
| Q: What is the CAS number of tert-Butyl heptafluorobutanoate? |
| A: CAS number of tert-Butyl heptafluorobutanoate is 425-24-1. |
| Q: What is the InChIKey of tert-Butyl heptafluorobutanoate? |
| A: InChIKey of tert-Butyl heptafluorobutanoate is JPVACFHILHDRGX-UHFFFAOYSA-N. |