1-bromo-3,3,4,4-tetrafluoropyrrolidine-2,5-dione structure
|
Common Name | 1-bromo-3,3,4,4-tetrafluoropyrrolidine-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 425-36-5 | Molecular Weight | 249.94600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4BrF4NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-bromo-3,3,4,4-tetrafluoropyrrolidine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4BrF4NO2 |
|---|---|
| Molecular Weight | 249.94600 |
| Exact Mass | 248.90500 |
| PSA | 37.38000 |
| LogP | 0.87360 |
| InChIKey | KWDJYEDQIJDOJI-UHFFFAOYSA-N |
| SMILES | O=C1N(Br)C(=O)C(F)(F)C1(F)F |
|
~%
1-bromo-3,3,4,4... CAS#:425-36-5 |
| Literature: Henne; Zimmer Journal of the American Chemical Society, 1951 , vol. 73, p. 1103 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N-Bromtetrafluorsuccinimid |
| 1-Brom-3,3,4,4-tetrafluor-pyrrolidin-2,5-dion |
| 2,5-Pyrrolidinedione,1-bromo-3,3,4,4-tetrafluoro |
| N-bromotetrafluorosuccinimide |
| 1-bromo-3,3,4,4-tetrafluoro-pyrrolidine-2,5-dione |