Phosphine oxide, diphenyl-1-propen-1-yl- structure
|
Common Name | Phosphine oxide, diphenyl-1-propen-1-yl- | ||
|---|---|---|---|---|
| CAS Number | 4252-89-5 | Molecular Weight | 242.25300 | |
| Density | 1.1g/cm3 | Boiling Point | 412.3ºC at 760mmHg | |
| Molecular Formula | C15H15OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.1ºC | |
| Name | [phenyl(prop-1-enyl)phosphoryl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 412.3ºC at 760mmHg |
| Molecular Formula | C15H15OP |
| Molecular Weight | 242.25300 |
| Flash Point | 203.1ºC |
| Exact Mass | 242.08600 |
| PSA | 26.88000 |
| LogP | 3.53410 |
| Index of Refraction | 1.571 |
| InChIKey | FRJXDOSETLXDIQ-XNJYKOPJSA-N |
| SMILES | CC=CP(=O)(c1ccccc1)c1ccccc1 |
|
~91%
Phosphine oxide... CAS#:4252-89-5 |
| Literature: Brett Runge; Mwangi, Martin T.; Bowden, Ned B. Journal of Organometallic Chemistry, 2006 , vol. 691, # 24-25 p. 5278 - 5288 |
|
~52%
Phosphine oxide... CAS#:4252-89-5 |
| Literature: Kharitonov, A. V.; Antoshin, A. E.; Pushin, A. N.; Tsvetkov, E. N. J. Gen. Chem. USSR (Engl. Transl.), 1988 , vol. 58, # 5 p. 1021 - 1024,905 - 908 |
|
~%
Detail
|
| Literature: Savignac, Philippe; Teulade, Marie-Paule; Aboujaoude, Elie Elia; Collignon, Noel Synthetic Communications, 1987 , vol. 17, # 13 p. 1559 - 1568 |
| (4-methoxyphenyl)-diphenylsulfanium |
| Diphenyl propenyl phosphine oxide |
| 1-propenyldiphenylphosphine oxide |
| diphenyl(4-methoxy phenyl)sulfonium triflate |
| diphenyl-p-methoxyphenylsulfonium triflate |
| Diphenylprop-1-enylphosphinoxid |
| diphenyl 1,2-propenylphosphine oxide |
| diphenylprop-1-enylphosphine oxide |
| 1-Propenyl-diphenyl-phosphinoxid |
| (4-Methoxyphenyl)diphenylsulfonium triflate |