[6-methoxy-3-(4-methoxyphenyl)-4-oxochromen-7-yl] acetate structure
|
Common Name | [6-methoxy-3-(4-methoxyphenyl)-4-oxochromen-7-yl] acetate | ||
|---|---|---|---|---|
| CAS Number | 4253-19-4 | Molecular Weight | 340.32700 | |
| Density | 1.284g/cm3 | Boiling Point | 497.4ºC at 760 mmHg | |
| Molecular Formula | C19H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.9ºC | |
| Name | [6-methoxy-3-(4-methoxyphenyl)-4-oxochromen-7-yl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.284g/cm3 |
|---|---|
| Boiling Point | 497.4ºC at 760 mmHg |
| Molecular Formula | C19H16O6 |
| Molecular Weight | 340.32700 |
| Flash Point | 219.9ºC |
| Exact Mass | 340.09500 |
| PSA | 74.97000 |
| LogP | 3.40250 |
| Index of Refraction | 1.586 |
| InChIKey | OLSFYFUZJCERJF-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2coc3cc(OC(C)=O)c(OC)cc3c2=O)cc1 |
| HS Code | 2915390090 |
|---|
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 7-O-acetylafromosin |
| 7-Hydroxy-4',6-dimethoxyisoflavone acetate |
| Afrormosin-monoacetat |
| Isoflavone,7-hydroxy-4',6-dimethoxy-,acetate |
| 7-Acetoxy-6,4'-dimethoxy-isoflavon |
| 7-O-Ac-afromosin |
| 7-O-acetylafrormosin |
| O-Acetyl-afromosin |
| Afromosin-acetat |
| Afrormosinacetat |
| O-Acetyl-afrormosin |