Methyl 4-hydroxy-3-methoxy-5-nitrobenzoate structure
|
Common Name | Methyl 4-hydroxy-3-methoxy-5-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 42590-00-1 | Molecular Weight | 227.17100 | |
| Density | 1.405g/cm3 | Boiling Point | 354.1ºC at 760 mmHg | |
| Molecular Formula | C9H9NO6 | Melting Point | 154-155 °C | |
| MSDS | N/A | Flash Point | 167.9ºC | |
| Name | Methyl 4-hydroxy-3-methoxy-5-nitrobenzenecarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.405g/cm3 |
|---|---|
| Boiling Point | 354.1ºC at 760 mmHg |
| Melting Point | 154-155 °C |
| Molecular Formula | C9H9NO6 |
| Molecular Weight | 227.17100 |
| Flash Point | 167.9ºC |
| Exact Mass | 227.04300 |
| PSA | 101.58000 |
| LogP | 1.61880 |
| Index of Refraction | 1.571 |
| InChIKey | ZQIHGTCQYHQBMY-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OC)c(O)c([N+](=O)[O-])c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
|
~75%
Methyl 4-hydrox... CAS#:42590-00-1 |
| Literature: Wang, Lin; Gong, Jianxian; Deng, Lujiang; Xiang, Zheng; Chen, Zhixing; Wang, Yuefan; Chen, Jiahua; Yang, Zhen Organic Letters, 2009 , vol. 11, # 8 p. 1809 - 1812 |
|
~%
Methyl 4-hydrox... CAS#:42590-00-1 |
| Literature: Klemenc Monatshefte fuer Chemie, 1912 , vol. 33, p. 389 |
|
~%
Methyl 4-hydrox... CAS#:42590-00-1 |
| Literature: Klemenc Monatshefte fuer Chemie, 1914 , vol. 35, p. 95 |
| Precursor 5 | |
|---|---|
| DownStream 6 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyl 4-hydroxy-3-methoxy-5-nitrobenzoate |