3-[acetyl-(4-ethoxycarbonylphenyl)amino]propanoic acid structure
|
Common Name | 3-[acetyl-(4-ethoxycarbonylphenyl)amino]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 4261-00-1 | Molecular Weight | 238.30900 | |
| Density | 1.251g/cm3 | Boiling Point | 475.4ºC at 760 mmHg | |
| Molecular Formula | C10H14N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.3ºC | |
| Name | (8-methyl-6-propylsulfanylpurin-9-yl)methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.251g/cm3 |
|---|---|
| Boiling Point | 475.4ºC at 760 mmHg |
| Molecular Formula | C10H14N4OS |
| Molecular Weight | 238.30900 |
| Flash Point | 241.3ºC |
| Exact Mass | 238.08900 |
| PSA | 89.13000 |
| LogP | 1.58660 |
| Index of Refraction | 1.563 |
| InChIKey | XICUBYXNKMRERR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(N(CCC(=O)O)C(C)=O)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N-(2,2'-Dipyridyl)acetamide |
| N,2'-Dipyridyl]acetamide |
| N-Acetyl-N'-<7-chloro-5-(2-chlorophenyl)-3H-1,4-benzodiazepin-2-yl>hydrazine |
| ACETAMIDE,N,N-(2,2'-DIPYRIDYL) |
| dipyrid-2-ylacetamide |
| N,N-dipyrid-2-yl acetamide |
| N-acetyl-N,N-dipyrid-2-yl |