4-Nitro-9-acridone structure
|
Common Name | 4-Nitro-9-acridone | ||
|---|---|---|---|---|
| CAS Number | 4261-62-5 | Molecular Weight | 240.21400 | |
| Density | 1.409g/cm3 | Boiling Point | 429.3ºC at 760 mmHg | |
| Molecular Formula | C13H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.4ºC | |
| Name | 4-nitro-10H-acridin-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.409g/cm3 |
|---|---|
| Boiling Point | 429.3ºC at 760 mmHg |
| Molecular Formula | C13H8N2O3 |
| Molecular Weight | 240.21400 |
| Flash Point | 213.4ºC |
| Exact Mass | 240.05300 |
| PSA | 78.68000 |
| LogP | 3.11270 |
| Index of Refraction | 1.672 |
| InChIKey | MMGYSMZGRLZCAS-UHFFFAOYSA-N |
| SMILES | O=c1c2ccccc2[nH]c2c([N+](=O)[O-])cccc12 |
| HS Code | 2933990090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-nitroacridin-9(10h)-one |
| 4-Nitro-10H-acridin-9-on |
| 4-Nitro-9-acridone |
| 4-Nitroacridone |
| Nitro-4 acridanone |
| 4-nitro-9(10H)-acridinone |
| 4-Nitro-acridon-(9) |
| 4-nitro-9(10)-acridinone |
| Disperse Yellow 2 |
| 9-Acridanone,4-nitro |