6-chloro-1,1-dioxo-3-(trichloromethyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide structure
|
Common Name | 6-chloro-1,1-dioxo-3-(trichloromethyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 4267-05-4 | Molecular Weight | 415.10100 | |
| Density | 1.831g/cm3 | Boiling Point | 628.1ºC at 760 mmHg | |
| Molecular Formula | C8H7Cl4N3O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 333.7ºC | |
| Name | 6-chloro-1,1-dioxo-3-(trichloromethyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.831g/cm3 |
|---|---|
| Boiling Point | 628.1ºC at 760 mmHg |
| Molecular Formula | C8H7Cl4N3O4S2 |
| Molecular Weight | 415.10100 |
| Flash Point | 333.7ºC |
| Exact Mass | 412.86300 |
| PSA | 135.12000 |
| LogP | 4.71620 |
| Index of Refraction | 1.641 |
| InChIKey | GUTZRTRUIMWMJZ-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1cc2c(cc1Cl)NC(C(Cl)(Cl)Cl)NS2(=O)=O |
|
~%
6-chloro-1,1-di... CAS#:4267-05-4 |
| Literature: Novello,F.C. et al. Journal of Organic Chemistry, 1960 , vol. 25, p. 970 - 981 |
|
~%
6-chloro-1,1-di... CAS#:4267-05-4 |
| Literature: Klosa,J.; Voigt,H. Journal fuer Praktische Chemie (Leipzig), 1962 , vol. 16, p. 264 - 276 |
|
~%
6-chloro-1,1-di... CAS#:4267-05-4 |
| Literature: Craveri,F.; Zoni,G. Bollettino Chimico Farmaceutico, 1961 , vol. 100, p. 956 - 971 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| Teclothiazidum |
| Tetrachlormethiazide |
| 6-Chlor-7-sulfamoyl-3-trichlormethyl-3,4-dihydro-1,2,4-benzothiodiazin-1,1-dioxid |
| 6-Chlor-7-sulfamoyl-3-trichlormethyl-1,1-dioxy-3,4-dihydro-2H-1,2,4-benzothiadiazin |
| PS 207 |
| Teclothiazide |
| Teclotiazide |
| Depleil |
| 6-Chlor-3-trichlormethyl-1,1-dioxy-7-sulfamoyl-3,4-dihydro-2H-1,2,4-benzothiadiazin |
| 6-Chlor-7-sulfamoyl-3-trichlormethyl-3,4-dihydro-1,2,4-benzothiadiazin-1,1-dioxid |
| 6-Chlor-3-trichlormethyl-7-sulfamoyl-3,4-dihydro-1,2,4-benzothiadiazin-1,1-dioxid |