3-Chloro-6-methoxyquinolin-4-ol structure
|
Common Name | 3-Chloro-6-methoxyquinolin-4-ol | ||
|---|---|---|---|---|
| CAS Number | 426842-72-0 | Molecular Weight | 209.62900 | |
| Density | 1.387g/cm3 | Boiling Point | 343.458ºC at 760 mmHg | |
| Molecular Formula | C10H8ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.518ºC | |
| Name | 3-chloro-6-methoxy-1H-quinolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.387g/cm3 |
|---|---|
| Boiling Point | 343.458ºC at 760 mmHg |
| Molecular Formula | C10H8ClNO2 |
| Molecular Weight | 209.62900 |
| Flash Point | 161.518ºC |
| Exact Mass | 209.02400 |
| PSA | 42.35000 |
| LogP | 2.60240 |
| Index of Refraction | 1.658 |
| InChIKey | RDNOZYLIMZPTDV-UHFFFAOYSA-N |
| SMILES | COc1ccc2[nH]cc(Cl)c(=O)c2c1 |
| HS Code | 2933499090 |
|---|
|
~%
3-Chloro-6-meth... CAS#:426842-72-0 |
| Literature: Baque, Eric; Carry, Jean-Christophe; El-Ahmad, Youssef; Evers, Michel; Hubert, Philippe; Malleron, Jean-Luc; Mignani, Serge; Pantel, Guy; Tabart, Michel; Viviani, Fabrice Patent: US2002/111492 A1, 2002 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Chloro-4-hydroxy-6-methoxyquinoline |
| 4-Quinolinol,3-chloro-6-methoxy |
| 3-chloro-6-methoxyquinolin-4-ol |