Gentrogenin
Gentrogenin structure
|
Common Name | Gentrogenin | ||
|---|---|---|---|---|
| CAS Number | 427-28-1 | Molecular Weight | 428.60400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H40O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Gentrogenin |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C27H40O4 |
|---|---|
| Molecular Weight | 428.60400 |
| Exact Mass | 428.29300 |
| PSA | 55.76000 |
| LogP | 4.89290 |
| Vapour Pressure | 6.84E-15mmHg at 25°C |
| InChIKey | UVLDESQWQRMYKD-MOAZMYQBSA-N |
| SMILES | CC1CCC2(OC1)OC1CC3C4CC=C5CC(O)CCC5(C)C4CC(=O)C3(C)C1C2C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:512-04-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Oxodiosgenin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Gentrogenin? |
| A: CAS number of Gentrogenin is 427-28-1. |
| Q: What is the LogP of Gentrogenin? |
| A: LogP of Gentrogenin is 4.89290. |
| Q: What is the English name of Gentrogenin? |
| A: The English name of Gentrogenin is Gentrogenin. |
| Q: What is the molecular weight of Gentrogenin? |
| A: Molecular weight of Gentrogenin is 428.60400. |
| Q: What is the InChIKey of Gentrogenin? |
| A: InChIKey of Gentrogenin is UVLDESQWQRMYKD-MOAZMYQBSA-N. |
| Q: What is the molecular formula of Gentrogenin? |
| A: Molecular formula of Gentrogenin is C27H40O4. |
| Q: What is the polar surface area (PSA) of Gentrogenin? |
| A: Polar surface area (PSA) of Gentrogenin is 55.76000. |
| Q: What is the SMILES notation of Gentrogenin? |
| A: SMILES notation of Gentrogenin is CC1CCC2(OC1)OC1CC3C4CC=C5CC(O)CCC5(C)C4CC(=O)C3(C)C1C2C. |
| Q: What is the Chinese name of 427-28-1? |
| A: Chinese name of 427-28-1 is 427-28-1. |
| Q: What English synonyms does Gentrogenin have? |
| A: English synonyms of Gentrogenin: Oxodiosgenin. |