1-(4-CHLOROPHENYL)-2,5-DIMETHYL-1H-PYRROLE-3-ACETICACI structure
|
Common Name | 1-(4-CHLOROPHENYL)-2,5-DIMETHYL-1H-PYRROLE-3-ACETICACI | ||
|---|---|---|---|---|
| CAS Number | 42718-19-4 | Molecular Weight | 236.09500 | |
| Density | N/A | Boiling Point | 278.1ºC at 760 mmHg | |
| Molecular Formula | C9H11Cl2NO2 | Melting Point | 199-202ºC | |
| MSDS | N/A | Flash Point | 122ºC | |
| Name | methyl 2-amino-2-(4-chlorophenyl)acetate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 278.1ºC at 760 mmHg |
|---|---|
| Melting Point | 199-202ºC |
| Molecular Formula | C9H11Cl2NO2 |
| Molecular Weight | 236.09500 |
| Flash Point | 122ºC |
| Exact Mass | 235.01700 |
| PSA | 52.32000 |
| LogP | 3.01510 |
| InChIKey | SLFXIBKUZFTNJA-UHFFFAOYSA-N |
| SMILES | COC(=O)C(N)c1ccc(Cl)cc1.Cl |
| HS Code | 2923900090 |
|---|
|
~99%
1-(4-CHLOROPHEN... CAS#:42718-19-4 |
| Literature: GLAXO GROUP LIMITED; UNIVERSITY OF NOTTINGHAM Patent: WO2008/92876 A1, 2008 ; Location in patent: Page/Page column 29 ; WO 2008/092876 A1 |
|
~98%
1-(4-CHLOROPHEN... CAS#:42718-19-4 |
| Literature: GLAXO GROUP LIMITED Patent: WO2007/116061 A1, 2007 ; Location in patent: Page/Page column 31-32 ; WO 2007/116061 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1-(4-chlorophenyl)-2-methoxy-2-oxoethanaminium chloride |
| (+/-)-4-chlorophenylalanine methyl ester hydrochloride |
| 4-chlorophenylglycine methyl ester hydrochloride |
| methylaminochlorophenylacetatehydrochloride |
| methyl amino(4-chlorophenyl)acetate hydrochloride |
| DL-2-(p-Chlorphenyl)glycinmethylester*HCl |
| methyl 2-amino-2-(4-chlorophenyl)acetate hydrochloride |