Naphthol AS-LC structure
|
Common Name | Naphthol AS-LC | ||
|---|---|---|---|---|
| CAS Number | 4273-92-1 | Molecular Weight | 357.78800 | |
| Density | 1.371 g/cm3 | Boiling Point | 479.8ºC | |
| Molecular Formula | C19H16ClNO4 | Melting Point | 190ºC | |
| MSDS | N/A | Flash Point | 244ºC | |
| Name | N-(4-chloro-2,5-dimethoxyphenyl)-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.371 g/cm3 |
|---|---|
| Boiling Point | 479.8ºC |
| Melting Point | 190ºC |
| Molecular Formula | C19H16ClNO4 |
| Molecular Weight | 357.78800 |
| Flash Point | 244ºC |
| Exact Mass | 357.07700 |
| PSA | 67.79000 |
| LogP | 4.54130 |
| Index of Refraction | 1.682 |
| InChIKey | QIHKTBRNOLQDGQ-UHFFFAOYSA-N |
| SMILES | COc1cc(NC(=O)c2cc3ccccc3cc2O)c(OC)cc1Cl |
| HS Code | 2924299090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Naphtazol LC |
| 3-Hydroxy-[2]naphthoesaeure-(4-chlor-2,5-dimethoxy-anilid) |
| Naphtol AS-LC |
| C.I. Azoic Coupling Component 23 |
| Naphthol AS-LC |
| 3-Oxy-naphthoesaeure-(2)-(4-chlor-2.5-dimethoxy-anilid) |
| Naphtol AS-LCLL |
| naphthol-AS-LC |
| Naphtanilide LC |
| 3-hydroxy-[2]naphthoic acid-(4-chloro-2,5-dimethoxy-anilide) |
| Sanatol LC |
| N-(4-Chloro-2,5-dimethoxyphenyl)-3-hydroxy-2-naphthamide |
| 4'-chloro-3-hydroxy-2',5'-dimethoxy-2-naphthanilide |
| N-(4-chloro-2,5-dimethoxyphenyl)-3-hydroxy-2-naphthalenecarboxamide |
| EINECS 224-270-6 |