1,3-diphenyl-2H-isoindole structure
|
Common Name | 1,3-diphenyl-2H-isoindole | ||
|---|---|---|---|---|
| CAS Number | 4276-23-7 | Molecular Weight | 269.34000 | |
| Density | 1.158g/cm3 | Boiling Point | 504.6ºC at 760 mmHg | |
| Molecular Formula | C20H15N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.3ºC | |
| Name | [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] 9H-xanthene-9-carboxylate,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.158g/cm3 |
|---|---|
| Boiling Point | 504.6ºC at 760 mmHg |
| Molecular Formula | C20H15N |
| Molecular Weight | 269.34000 |
| Flash Point | 211.3ºC |
| Exact Mass | 269.12000 |
| PSA | 15.79000 |
| LogP | 5.50190 |
| Index of Refraction | 1.678 |
| InChIKey | YWCJNTKODUBZBV-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2[nH]c(-c3ccccc3)c3ccccc23)cc1 |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-diphenyl-isobenzofuran-5,6-dicarbaldehyde |
| 1,3-diphenyl-isoindole |
| Diphenylisoindol |
| 1,3-Diphenyl-isoindol |
| 5,6-Diformyl-1,3-diphenylisobenzofuran |
| 5,6-Isobenzofurandicarboxaldehyde,1,3-diphenyl |