2-[1-(4-chlorophenyl)-2-methyl-5-(4-methylphenyl)pyrrol-3-yl]acetic acid
Modify Date: 2025-09-22 10:07:06
![2-[1-(4-chlorophenyl)-2-methyl-5-(4-methylphenyl)pyrrol-3-yl]acetic acid Structure](https://image.chemsrc.com/caspic/396/42780-06-3.png)
2-[1-(4-chlorophenyl)-2-methyl-5-(4-methylphenyl)pyrrol-3-yl]acetic acid structure
|
Common Name | 2-[1-(4-chlorophenyl)-2-methyl-5-(4-methylphenyl)pyrrol-3-yl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 42780-06-3 | Molecular Weight | 339.81500 | |
| Density | 1.2g/cm3 | Boiling Point | 515.1ºC at 760mmHg | |
| Molecular Formula | C20H18ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.3ºC | |
| Name | 2-[1-(4-chlorophenyl)-2-methyl-5-(4-methylphenyl)pyrrol-3-yl]acetic acid |
|---|
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 515.1ºC at 760mmHg |
| Molecular Formula | C20H18ClNO2 |
| Molecular Weight | 339.81500 |
| Flash Point | 265.3ºC |
| Exact Mass | 339.10300 |
| PSA | 42.23000 |
| LogP | 5.04160 |
| Index of Refraction | 1.604 |
| InChIKey | XMZIJZRQONCISB-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2cc(CC(=O)O)c(C)n2-c2ccc(Cl)cc2)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |