2-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]acetonitrile structure
|
Common Name | 2-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]acetonitrile | ||
|---|---|---|---|---|
| CAS Number | 42780-46-1 | Molecular Weight | 240.30000 | |
| Density | 1.05g/cm3 | Boiling Point | 408.7ºC at 760mmHg | |
| Molecular Formula | C15H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201ºC | |
| Name | 2-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]acetonitrile |
|---|
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 408.7ºC at 760mmHg |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.30000 |
| Flash Point | 201ºC |
| Exact Mass | 240.12600 |
| PSA | 37.95000 |
| LogP | 3.16878 |
| Index of Refraction | 1.554 |
| InChIKey | YLDPOAXXEUFVSK-UHFFFAOYSA-N |
| SMILES | COc1ccc(-n2c(C)cc(CC#N)c2C)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |