ethenyl 2-(2,4-dichlorophenoxy)acetate
Modify Date: 2025-11-30 21:43:56
ethenyl 2-(2,4-dichlorophenoxy)acetate structure
|
Common Name | ethenyl 2-(2,4-dichlorophenoxy)acetate | ||
|---|---|---|---|---|
| CAS Number | 4280-66-4 | Molecular Weight | 247.07500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethenyl 2-(2,4-dichlorophenoxy)acetate |
|---|
| Molecular Formula | C10H8Cl2O3 |
|---|---|
| Molecular Weight | 247.07500 |
| Exact Mass | 245.98500 |
| PSA | 35.53000 |
| LogP | 3.05890 |
| InChIKey | MRQZSXQEGOSLMV-UHFFFAOYSA-N |
| SMILES | C=COC(=O)COc1ccc(Cl)cc1Cl |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |