tert-Butyl 2-(4-hydroxyphenoxy)acetate structure
|
Common Name | tert-Butyl 2-(4-hydroxyphenoxy)acetate | ||
|---|---|---|---|---|
| CAS Number | 42806-92-8 | Molecular Weight | 224.25300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-Butyl 2-(4-hydroxyphenoxy)acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H16O4 |
|---|---|
| Molecular Weight | 224.25300 |
| Exact Mass | 224.10500 |
| PSA | 55.76000 |
| LogP | 2.11270 |
| InChIKey | YYDLJZGSVBZPSF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COc1ccc(O)cc1 |
| HS Code | 2918990090 |
|---|
|
~53%
tert-Butyl 2-(4... CAS#:42806-92-8 |
| Literature: ANORMED INC. Patent: WO2007/22371 A2, 2007 ; Location in patent: Page/Page column 68 ; WO 2007/022371 A2 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| tert.-Butyl-2-(p-hydroxyphenoxy)-acetat |
| tert-butyl(4-hydroxyphenoxy)acetate |
| tert-butyl 2-(4-hydroxyphenoxy)ethanoate |
| tertbutylhydroxyphenoxyacetate |
| (4-hydroxy-phenoxy)-acetic acid tert-butyl ester |