3-(aminoiminomethyl)-benzoic acid hcl structure
|
Common Name | 3-(aminoiminomethyl)-benzoic acid hcl | ||
|---|---|---|---|---|
| CAS Number | 42823-63-2 | Molecular Weight | 200.62200 | |
| Density | N/A | Boiling Point | 387ºC at 760 mmHg | |
| Molecular Formula | C8H9ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.9ºC | |
| Name | 3-(aminoiminomethyl)-benzoic acid hcl |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 387ºC at 760 mmHg |
|---|---|
| Molecular Formula | C8H9ClN2O2 |
| Molecular Weight | 200.62200 |
| Flash Point | 187.9ºC |
| Exact Mass | 200.03500 |
| PSA | 87.17000 |
| LogP | 2.27090 |
| InChIKey | CXEOLJZRKPZDRK-UHFFFAOYSA-N |
| SMILES | Cl.N=C(N)c1cccc(C(=O)O)c1 |
| HS Code | 2925290090 |
|---|
|
~82%
3-(aminoiminome... CAS#:42823-63-2 |
| Literature: Girnys, Elizabeth A.; Porter, Vanessa R.; Mosberg, Henry I. Bioorganic and Medicinal Chemistry, 2011 , vol. 19, # 24 p. 7425 - 7434 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3-Amidinobenzoesaeure-hydrochlorid |
| 3-amidinobenzoic acid hydrochloride |