1,7-dihydroxy-3,6-dimethoxyxanthen-9-one structure
|
Common Name | 1,7-dihydroxy-3,6-dimethoxyxanthen-9-one | ||
|---|---|---|---|---|
| CAS Number | 42833-92-1 | Molecular Weight | 288.25200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,7-dihydroxy-3,6-dimethoxyxanthen-9-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H12O6 |
|---|---|
| Molecular Weight | 288.25200 |
| Exact Mass | 288.06300 |
| PSA | 89.13000 |
| LogP | 2.37460 |
| InChIKey | QLUQJJQNWLPDOM-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c2c(=O)c3cc(O)c(OC)cc3oc2c1 |
|
~%
1,7-dihydroxy-3... CAS#:42833-92-1 |
| Literature: Cotterill, Phillip J.; Scheinmann, Feodor Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 2353 - 2357 |
|
~%
1,7-dihydroxy-3... CAS#:42833-92-1 |
| Literature: Cotterill, Phillip J.; Scheinmann, Feodor Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 2353 - 2357 |
|
~%
1,7-dihydroxy-3... CAS#:42833-92-1 |
| Literature: Cotterill, Phillip J.; Scheinmann, Feodor Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 2353 - 2357 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 9H-Xanthen-9-one,1,7-dihydroxy-3,6-dimethoxy |
| 1,7-dihydroxy-3,6-dimethoxy-xanthen-9-one |
| 1,7-dihydroxy-3,6-dimethoxyxanthone |