5-Bromo-2-[(4-chlorobenzyl)oxy]benzaldehyde
Modify Date: 2025-09-02 10:38:12
![5-Bromo-2-[(4-chlorobenzyl)oxy]benzaldehyde Structure](https://image.chemsrc.com/caspic/451/428482-55-7.png)
5-Bromo-2-[(4-chlorobenzyl)oxy]benzaldehyde structure
|
Common Name | 5-Bromo-2-[(4-chlorobenzyl)oxy]benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 428482-55-7 | Molecular Weight | 325.58500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10BrClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-Bromo-2-[(4-chlorobenzyl)oxy]benzaldehyde |
|---|
| Molecular Formula | C14H10BrClO2 |
|---|---|
| Molecular Weight | 325.58500 |
| Exact Mass | 323.95500 |
| PSA | 26.30000 |
| LogP | 4.49400 |
| InChIKey | QKGSIAHFSHYDIY-UHFFFAOYSA-N |
| SMILES | O=Cc1cc(Br)ccc1OCc1ccc(Cl)cc1 |
| HS Code | 2913000090 |
|---|
|
~99%
5-Bromo-2-[(4-c... CAS#:428482-55-7 |
| Literature: Schering Aktiengesellschaft Patent: US2005/101644 A1, 2005 ; Location in patent: Page/Page column 32 ; US 20050101644 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |