3-(2,4-dichlorophenyl)-2-methylquinazolin-4-one
Modify Date: 2025-10-05 20:17:27
3-(2,4-dichlorophenyl)-2-methylquinazolin-4-one structure
|
Common Name | 3-(2,4-dichlorophenyl)-2-methylquinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 4285-65-8 | Molecular Weight | 305.15900 | |
| Density | 1.39g/cm3 | Boiling Point | 461.6ºC at 760 mmHg | |
| Molecular Formula | C15H10Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.9ºC | |
| Name | 3-(2,4-dichlorophenyl)-2-methylquinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 461.6ºC at 760 mmHg |
| Molecular Formula | C15H10Cl2N2O |
| Molecular Weight | 305.15900 |
| Flash Point | 232.9ºC |
| Exact Mass | 304.01700 |
| PSA | 34.89000 |
| LogP | 4.00090 |
| Index of Refraction | 1.66 |
| InChIKey | GCFCLPQARRCRAG-UHFFFAOYSA-N |
| SMILES | Cc1nc2ccccc2c(=O)n1-c1ccc(Cl)cc1Cl |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-<2.4-Dichlor-phenyl>-2-methyl-3H-chinazolin-4-on |