Hexane,1,6-dinitro- structure
|
Common Name | Hexane,1,6-dinitro- | ||
|---|---|---|---|---|
| CAS Number | 4286-47-9 | Molecular Weight | 176.17000 | |
| Density | 1.15g/cm3 | Boiling Point | 290.7ºC at 760mmHg | |
| Molecular Formula | C6H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.2ºC | |
| Name | 1,6-dinitrohexane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 290.7ºC at 760mmHg |
| Molecular Formula | C6H12N2O4 |
| Molecular Weight | 176.17000 |
| Flash Point | 135.2ºC |
| Exact Mass | 176.08000 |
| PSA | 91.64000 |
| LogP | 2.14660 |
| Index of Refraction | 1.459 |
| InChIKey | YXBHCFHBPVLHEZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])CCCCCC[N+](=O)[O-] |
|
~%
Hexane,1,6-dinitro- CAS#:4286-47-9 |
| Literature: Stille,J.K.; Vessel,E.D. Journal of Organic Chemistry, 1960 , vol. 25, p. 478 - 480 |
|
~%
Hexane,1,6-dinitro- CAS#:4286-47-9 |
| Literature: Feuer; Leston Organic Syntheses, 1954 , vol. 34, p. 37 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Hexane,1,6-dinitro |
| 1,6-Dinitro-hexan |
| 1,6-dinitro-hexane |