ethyl 3-hydroxy-1-methylindole-2-carboxylate structure
|
Common Name | ethyl 3-hydroxy-1-methylindole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 42871-90-9 | Molecular Weight | 219.23700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 3-hydroxy-1-methylindole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13NO3 |
|---|---|
| Molecular Weight | 219.23700 |
| Exact Mass | 219.09000 |
| PSA | 51.46000 |
| LogP | 2.06060 |
| InChIKey | WCYURHXDMXGKQD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(O)c2ccccc2n1C |
|
~42%
ethyl 3-hydroxy... CAS#:42871-90-9 |
| Literature: Sukari, Mohamed A.; Vernon, John M. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 2219 - 2224 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| 1H-Indole-2-carboxylic acid,3-hydroxy-1-methyl-,ethyl ester |
| ethyl 3-hydroxy-1-methyl-1H-2-indolecarboxylate |
| ethyl 3-hydroxy-1-methyl-1H-indole-2-carboxylate |
| 3-hydroxy-1-methyl-1H-indole-2-carboxylic acid ethyl ester |
| 3-hydroxy-1-methyl-indole-2-carboxylic acid ethyl ester |