4-chloro-2-phenylisoindole-1,3-dione structure
|
Common Name | 4-chloro-2-phenylisoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 42899-83-2 | Molecular Weight | 257.67200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H8ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-2-phenylisoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H8ClNO2 |
|---|---|
| Molecular Weight | 257.67200 |
| Exact Mass | 257.02400 |
| PSA | 37.38000 |
| LogP | 3.20560 |
| InChIKey | VVQTYZKVZLDUND-UHFFFAOYSA-N |
| SMILES | O=C1c2cccc(Cl)c2C(=O)N1c1ccccc1 |
|
~%
4-chloro-2-phen... CAS#:42899-83-2 |
| Literature: Marriott; Robinson Journal of the Chemical Society, 1939 , p. 134,137 |
|
~%
4-chloro-2-phen... CAS#:42899-83-2 |
| Literature: Marriott; Robinson Journal of the Chemical Society, 1939 , p. 134,137 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-chloro-2-phenyl-isoindoline-1,3-dione |
| 4-Chlor-2-phenyl-isoindolin-1,3-dion |
| 3-Chlor-N-phenyl-phthalimid |
| 4-chloro-2-phenyl-isoindole-1,3-dione |
| 3-chloro-N-phenyl-phthalimide |