4-chloro-2-phenylisoindole-1,3-dione
4-chloro-2-phenylisoindole-1,3-dione structure
|
Common Name | 4-chloro-2-phenylisoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 42899-83-2 | Molecular Weight | 257.67200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H8ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-chloro-2-phenylisoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H8ClNO2 |
|---|---|
| Molecular Weight | 257.67200 |
| Exact Mass | 257.02400 |
| PSA | 37.38000 |
| LogP | 3.20560 |
| InChIKey | VVQTYZKVZLDUND-UHFFFAOYSA-N |
| SMILES | O=C1c2cccc(Cl)c2C(=O)N1c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-chloro-2-phen... CAS#:42899-83-2 |
| Literature: Marriott; Robinson Journal of the Chemical Society, 1939 , p. 134,137 |
|
~%
4-chloro-2-phen... CAS#:42899-83-2 |
| Literature: Marriott; Robinson Journal of the Chemical Society, 1939 , p. 134,137 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-chloro-2-phenyl-isoindoline-1,3-dione |
| 4-Chlor-2-phenyl-isoindolin-1,3-dion |
| 3-Chlor-N-phenyl-phthalimid |
| 4-chloro-2-phenyl-isoindole-1,3-dione |
| 3-chloro-N-phenyl-phthalimide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-chloro-2-phenylisoindole-1,3-dione? |
| A: Molecular formula of 4-chloro-2-phenylisoindole-1,3-dione is C14H8ClNO2. |
| Q: What is the LogP of 4-chloro-2-phenylisoindole-1,3-dione? |
| A: LogP of 4-chloro-2-phenylisoindole-1,3-dione is 3.20560. |
| Q: What is the CAS number of 4-chloro-2-phenylisoindole-1,3-dione? |
| A: CAS number of 4-chloro-2-phenylisoindole-1,3-dione is 42899-83-2. |
| Q: What is the SMILES notation of 4-chloro-2-phenylisoindole-1,3-dione? |
| A: SMILES notation of 4-chloro-2-phenylisoindole-1,3-dione is O=C1c2cccc(Cl)c2C(=O)N1c1ccccc1. |
| Q: What are the upstream materials of 4-chloro-2-phenylisoindole-1,3-dione? |
| A: Related upstream materials(CAS) of 4-chloro-2-phenylisoindole-1,3-dione: 117-21-5;27563-65-1. |
| Q: What English synonyms does 4-chloro-2-phenylisoindole-1,3-dione have? |
| A: English synonyms of 4-chloro-2-phenylisoindole-1,3-dione: 4-chloro-2-phenyl-isoindoline-1,3-dione, 4-Chlor-2-phenyl-isoindolin-1,3-dion, 3-Chlor-N-phenyl-phthalimid, 4-chloro-2-phenyl-isoindole-1,3-dione, 3-chloro-N-phenyl-phthalimide. |
| Q: What is the polar surface area (PSA) of 4-chloro-2-phenylisoindole-1,3-dione? |
| A: Polar surface area (PSA) of 4-chloro-2-phenylisoindole-1,3-dione is 37.38000. |
| Q: What is the English name of 4-chloro-2-phenylisoindole-1,3-dione? |
| A: The English name of 4-chloro-2-phenylisoindole-1,3-dione is 4-chloro-2-phenylisoindole-1,3-dione. |
| Q: What is the molecular weight of 4-chloro-2-phenylisoindole-1,3-dione? |
| A: Molecular weight of 4-chloro-2-phenylisoindole-1,3-dione is 257.67200. |
| Q: What is the InChIKey of 4-chloro-2-phenylisoindole-1,3-dione? |
| A: InChIKey of 4-chloro-2-phenylisoindole-1,3-dione is VVQTYZKVZLDUND-UHFFFAOYSA-N. |