dl-leucyl-glycyl-dl-phenylalanine structure
|
Common Name | dl-leucyl-glycyl-dl-phenylalanine | ||
|---|---|---|---|---|
| CAS Number | 4294-25-1 | Molecular Weight | 335.39800 | |
| Density | 1.188g/cm3 | Boiling Point | 635.7ºC at 760 mmHg | |
| Molecular Formula | C17H25N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 338.3ºC | |
| Name | 2-[[2-[(2-amino-4-methylpentanoyl)amino]acetyl]amino]-3-phenylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 635.7ºC at 760 mmHg |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.39800 |
| Flash Point | 338.3ºC |
| Exact Mass | 335.18500 |
| PSA | 121.52000 |
| LogP | 1.77020 |
| Index of Refraction | 1.548 |
| InChIKey | KEVYYIMVELOXCT-UHFFFAOYSA-N |
| SMILES | CC(C)CC(N)C(=O)NCC(=O)NC(Cc1ccccc1)C(=O)O |
| Storage condition | -15°C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Leucyl=>glycyl=>phenylalanin |
| Inakt. Leucyl-glycyl-phenylalanin |
| leucylglycylphenylalanine |
| H-DL-Leu-Gly-DL-Phe-OH |
| DL-LEU-GLY-DL-PHE |
| DL-Leucylglycyl-DL-phenylalanine |
| DL-LEUCYLGLYCYL-DL-PHENYLALANINE |
| DL-LEUCYL-GLYCYL-DL-PHENYLALANINE |
| leu-gly-phe |