1,6-bis(trimethylsilyl)hept-6-en-1-yn-3-ol structure
|
Common Name | 1,6-bis(trimethylsilyl)hept-6-en-1-yn-3-ol | ||
|---|---|---|---|---|
| CAS Number | 429680-32-0 | Molecular Weight | 254.51600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H26OSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,6-bis(trimethylsilyl)hept-6-en-1-yn-3-ol |
|---|
| Molecular Formula | C13H26OSi2 |
|---|---|
| Molecular Weight | 254.51600 |
| Exact Mass | 254.15200 |
| PSA | 20.23000 |
| LogP | 3.44190 |
| InChIKey | UGOKLHXAADWGAZ-UHFFFAOYSA-N |
| SMILES | C=C(CCC(O)C#C[Si](C)(C)C)[Si](C)(C)C |
|
~94%
1,6-bis(trimeth... CAS#:429680-32-0 |
| Literature: Lopez, Fernando; Castedo, Luis; Mascarenas, Jose L. Journal of the American Chemical Society, 2002 , vol. 124, # 16 p. 4218 - 4219 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |