N-(4-fluoro-3-nitrophenyl)-4-methylbenzamide structure
|
Common Name | N-(4-fluoro-3-nitrophenyl)-4-methylbenzamide | ||
|---|---|---|---|---|
| CAS Number | 4297-70-5 | Molecular Weight | 274.24700 | |
| Density | 1.366g/cm3 | Boiling Point | 343.1ºC at 760 mmHg | |
| Molecular Formula | C14H11FN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.3ºC | |
| Name | N-(4-fluoro-3-nitrophenyl)-4-methylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.366g/cm3 |
|---|---|
| Boiling Point | 343.1ºC at 760 mmHg |
| Molecular Formula | C14H11FN2O3 |
| Molecular Weight | 274.24700 |
| Flash Point | 161.3ºC |
| Exact Mass | 274.07500 |
| PSA | 74.92000 |
| LogP | 3.89080 |
| Index of Refraction | 1.638 |
| InChIKey | WNDQSOIFUBJSIO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)cc1 |
| HS Code | 2928000090 |
|---|
|
~%
N-(4-fluoro-3-n... CAS#:4297-70-5 |
| Literature: Nikolaev,A.F. et al. J. Gen. Chem. USSR (Engl. Transl.), 1964 , vol. 34, p. 3087 - 3089,3125 - 3127 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| N-Vinyl-N'-aminosuccinamid |
| Bernsteinsaeure-vinylamid-hydrazid |