Aniline-4-beta-ethyl sulfonyl sulfate-2-sulfonic acid structure
|
Common Name | Aniline-4-beta-ethyl sulfonyl sulfate-2-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 42986-22-1 | Molecular Weight | 361.36900 | |
| Density | 1.828g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H11NO9S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-5-(2-sulfooxyethylsulfonyl)benzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.828g/cm3 |
|---|---|
| Molecular Formula | C8H11NO9S3 |
| Molecular Weight | 361.36900 |
| Exact Mass | 360.96000 |
| PSA | 203.27000 |
| LogP | 2.93220 |
| Index of Refraction | 1.636 |
| InChIKey | UQEAQYXIDTYYNI-UHFFFAOYSA-N |
| SMILES | Nc1ccc(S(=O)(=O)CCOS(=O)(=O)O)cc1S(=O)(=O)O |
| HS Code | 2922199090 |
|---|
|
~41%
Aniline-4-beta-... CAS#:42986-22-1 |
| Literature: WO2005/85190 A1, ; Page/Page column 4-5 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzenesulfonic acid,2-amino-5-((2-(sulfooxy)ethyl)sulfonyl) |
| 2-sulfo-4-(2-sulfatoethylsulfonyl)-aniline |
| 2-[(3-sulfo-4-aminobenzene)sulfonyl]ethoxysulfonic acid |