butyl 2,2-bis(4-chlorophenyl)acetate structure
|
Common Name | butyl 2,2-bis(4-chlorophenyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 42991-55-9 | Molecular Weight | 337.24000 | |
| Density | 1.206g/cm3 | Boiling Point | 425.8ºC at 760 mmHg | |
| Molecular Formula | C18H18Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.8ºC | |
| Name | butyl 2,2-bis(4-chlorophenyl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.206g/cm3 |
|---|---|
| Boiling Point | 425.8ºC at 760 mmHg |
| Molecular Formula | C18H18Cl2O2 |
| Molecular Weight | 337.24000 |
| Flash Point | 152.8ºC |
| Exact Mass | 336.06800 |
| PSA | 26.30000 |
| LogP | 5.46860 |
| Index of Refraction | 1.559 |
| InChIKey | POHHNDQPDMJXPR-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)C(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| HS Code | 2916399090 |
|---|
|
~76%
butyl 2,2-bis(4... CAS#:42991-55-9 |
| Literature: Song, Bingrui; Himmler, Thomas; Goossen, Lukas J. Advanced Synthesis and Catalysis, 2011 , vol. 353, # 10 p. 1688 - 1694 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Bis-(4-chlor-phenyl)-essigsaeure-butylester |
| bis-(4-chloro-phenyl)-acetic acid butyl ester |