4-(4-chlorophenyl)benzoyl chloride structure
|
Common Name | 4-(4-chlorophenyl)benzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 43007-85-8 | Molecular Weight | 251.10800 | |
| Density | 1.301g/cm3 | Boiling Point | 364.054ºC at 760 mmHg | |
| Molecular Formula | C13H8Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.864ºC | |
| Name | 4-(4-chlorophenyl)benzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.301g/cm3 |
|---|---|
| Boiling Point | 364.054ºC at 760 mmHg |
| Molecular Formula | C13H8Cl2O |
| Molecular Weight | 251.10800 |
| Flash Point | 143.864ºC |
| Exact Mass | 249.99500 |
| PSA | 17.07000 |
| LogP | 4.38600 |
| Index of Refraction | 1.599 |
| InChIKey | YKQYDMMGXFPAEB-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1ccc(-c2ccc(Cl)cc2)cc1 |
| HS Code | 2916399090 |
|---|
|
~93%
4-(4-chlorophen... CAS#:43007-85-8 |
| Literature: Rodefeld, Lars; Klausener, Alexander; Ullrich, Friedrich-Wilhelm Patent: US2002/62043 A1, 2002 ; |
|
~%
4-(4-chlorophen... CAS#:43007-85-8 |
| Literature: Takeda Chemical Industries, Ltd. Patent: EP1447402 A1, 2004 ; Location in patent: Page 84 ; EP 1447402 A1 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4'-Chlor-biphenyl-4-carbonylchlorid |
| 4'-chloro-biphenyl-4-carbonyl chloride |
| 4'-Chlorobiphenyl-4-carboxylic acid chloride |