(2-methylsulfonyl-1-phenylethenyl)benzene structure
|
Common Name | (2-methylsulfonyl-1-phenylethenyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 43013-82-7 | Molecular Weight | 258.33500 | |
| Density | 1.185g/cm3 | Boiling Point | 442.6ºC at 760 mmHg | |
| Molecular Formula | C15H14O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.2ºC | |
| Name | (2-methylsulfonyl-1-phenylethenyl)benzene |
|---|
| Density | 1.185g/cm3 |
|---|---|
| Boiling Point | 442.6ºC at 760 mmHg |
| Molecular Formula | C15H14O2S |
| Molecular Weight | 258.33500 |
| Flash Point | 273.2ºC |
| Exact Mass | 258.07100 |
| PSA | 42.52000 |
| LogP | 4.20120 |
| Index of Refraction | 1.593 |
| InChIKey | CVKHZXOHMMKYAT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C=C(c1ccccc1)c1ccccc1 |
|
~%
(2-methylsulfon... CAS#:43013-82-7 |
| Literature: Truce; Buser Journal of the American Chemical Society, 1954 , vol. 76, p. 3577 |
|
~%
(2-methylsulfon... CAS#:43013-82-7 |
| Literature: Truce; Buser Journal of the American Chemical Society, 1954 , vol. 76, p. 3577 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |