5,6-dibromo-1,2-Acenaphthylenedione structure
|
Common Name | 5,6-dibromo-1,2-Acenaphthylenedione | ||
|---|---|---|---|---|
| CAS Number | 43017-99-8 | Molecular Weight | 339.96700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H4Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,6-dibromoacenaphthylene-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H4Br2O2 |
|---|---|
| Molecular Weight | 339.96700 |
| Exact Mass | 337.85800 |
| PSA | 34.14000 |
| LogP | 3.74380 |
| InChIKey | GAZOIWWLVDAXSC-UHFFFAOYSA-N |
| SMILES | O=C1C(=O)c2ccc(Br)c3c(Br)ccc1c23 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 5,6-dibromo-1,2-acenaphthenequinone |
| 1,2-Acenaphthylenedione,5,6-dibromo |
| 5,6-dibromo-1,2-acenaphthylenedione |
| 5,6-dibromo-acenaphthene-1,2-dione |
| 1,8-dibromoacenaphthenedione |
| 5,6-dibromoacenaphthylen-1,2-dione |
| 5,6-Dibrom-acenaphthen-1,2-dion |