4-[(3-bromo-4-methoxyphenyl)methylidene]-2-methylsulfanyl-1,3-thiazol-5-one structure
|
Common Name | 4-[(3-bromo-4-methoxyphenyl)methylidene]-2-methylsulfanyl-1,3-thiazol-5-one | ||
|---|---|---|---|---|
| CAS Number | 430464-08-7 | Molecular Weight | 344.24700 | |
| Density | 1.58g/cm3 | Boiling Point | 479ºC at 760 mmHg | |
| Molecular Formula | C12H10BrNO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.5ºC | |
| Name | 4-[(3-bromo-4-methoxyphenyl)methylidene]-2-methylsulfanyl-1,3-thiazol-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 479ºC at 760 mmHg |
| Molecular Formula | C12H10BrNO2S2 |
| Molecular Weight | 344.24700 |
| Flash Point | 243.5ºC |
| Exact Mass | 342.93400 |
| PSA | 89.26000 |
| LogP | 3.22660 |
| Index of Refraction | 1.667 |
| InChIKey | WEBQBZVQQKVABN-TWGQIWQCSA-N |
| SMILES | COc1ccc(C=C2N=C(SC)SC2=O)cc1Br |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| (4z)-4-(3-bromo-4-methoxybenzylidene)-2-(methylthio)-1,3-thiazol-5(4h)-one |