2-(2-Hydroxy-3-phenylacryloyl)benzoic acid structure
|
Common Name | 2-(2-Hydroxy-3-phenylacryloyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 43053-07-2 | Molecular Weight | 268.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-hydroxy-3-phenylprop-2-enoyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12O4 |
|---|---|
| Molecular Weight | 268.26400 |
| Exact Mass | 268.07400 |
| PSA | 74.60000 |
| LogP | 3.16660 |
| InChIKey | GNNPNKIWDULLFI-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1C(=O)C(O)=Cc1ccccc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(2-Hydroxy-3-phenylacryloyl)benzoic acid |
| 2-((E)-2-HYDROXY-3-PHENYLACRYLOYL)BENZOIC ACID |