2,6-Di-tert-butyl-4-nonylphenol
2,6-Di-tert-butyl-4-nonylphenol structure
|
Common Name | 2,6-Di-tert-butyl-4-nonylphenol | ||
|---|---|---|---|---|
| CAS Number | 4306-88-1 | Molecular Weight | 332.56300 | |
| Density | 0.899 g/cm3 | Boiling Point | 389.6ºC at 760 mmHg | |
| Molecular Formula | C23H40O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.8ºC | |
Summary: 2,6-Di-tert-butyl-4-nonylphenol (Chinese name: 2,6-二-叔丁基-4-壬苯酚, CAS number: 4306-88-1) is a transparent liquid with molecular formula C23H40O and molecular weight 332.56300. Its boiling point is 389.6℃ and density is 0.899 g/cm³. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,6-Di-tert-butyl-4-nonylphenol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.899 g/cm3 |
|---|---|
| Boiling Point | 389.6ºC at 760 mmHg |
| Molecular Formula | C23H40O |
| Molecular Weight | 332.56300 |
| Flash Point | 175.8ºC |
| Exact Mass | 332.30800 |
| PSA | 20.23000 |
| LogP | 7.28030 |
| Index of Refraction | 1.63 |
| InChIKey | VQQLTEBUMLSLFJ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| isonox(r) 232 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 2,6-Di-tert-butyl-4-nonylphenol? |
| A: Boiling point of 2,6-Di-tert-butyl-4-nonylphenol is 389.6ºC at 760 mmHg. |
| Q: What English synonyms does 2,6-Di-tert-butyl-4-nonylphenol have? |
| A: English synonyms of 2,6-Di-tert-butyl-4-nonylphenol: isonox(r) 232. |
| Q: What is the molecular weight of 2,6-Di-tert-butyl-4-nonylphenol? |
| A: Molecular weight of 2,6-Di-tert-butyl-4-nonylphenol is 332.56300. |
| Q: What is the polar surface area (PSA) of 2,6-Di-tert-butyl-4-nonylphenol? |
| A: Polar surface area (PSA) of 2,6-Di-tert-butyl-4-nonylphenol is 20.23000. |
| Q: What is the SMILES notation of 2,6-Di-tert-butyl-4-nonylphenol? |
| A: SMILES notation of 2,6-Di-tert-butyl-4-nonylphenol is CCCCCCCCCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1. |
| Q: What is the English name of 2,6-Di-tert-butyl-4-nonylphenol? |
| A: The English name of 2,6-Di-tert-butyl-4-nonylphenol is 2,6-Di-tert-butyl-4-nonylphenol. |
| Q: What is the LogP of 2,6-Di-tert-butyl-4-nonylphenol? |
| A: LogP of 2,6-Di-tert-butyl-4-nonylphenol is 7.28030. |
| Q: What is the molecular formula of 2,6-Di-tert-butyl-4-nonylphenol? |
| A: Molecular formula of 2,6-Di-tert-butyl-4-nonylphenol is C23H40O. |
| Q: What is the InChIKey of 2,6-Di-tert-butyl-4-nonylphenol? |
| A: InChIKey of 2,6-Di-tert-butyl-4-nonylphenol is VQQLTEBUMLSLFJ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2,6-Di-tert-butyl-4-nonylphenol? |
| A: CAS number of 2,6-Di-tert-butyl-4-nonylphenol is 4306-88-1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |