dimethyl 2-hydroxy-2-propan-2-ylbutanedioate structure
|
Common Name | dimethyl 2-hydroxy-2-propan-2-ylbutanedioate | ||
|---|---|---|---|---|
| CAS Number | 43064-52-4 | Molecular Weight | 204.22000 | |
| Density | 1.122g/cm3 | Boiling Point | 284.6ºC at 760 mmHg | |
| Molecular Formula | C9H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 104.3ºC | |
| Name | dimethyl 2-hydroxy-2-propan-2-ylbutanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.122g/cm3 |
|---|---|
| Boiling Point | 284.6ºC at 760 mmHg |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22000 |
| Flash Point | 104.3ºC |
| Exact Mass | 204.10000 |
| PSA | 72.83000 |
| LogP | 0.10960 |
| Index of Refraction | 1.448 |
| InChIKey | OQIDMHZJNDYZLB-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(O)(C(=O)OC)C(C)C |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| EINECS 256-072-0 |
| dimethyl 2-hydroxy-2-isopropylbutanedioate |