methyl 7-ethyl-3-methyl-2,8-dioxo-9-oxa-3-azabicyclo[4.4.0]deca-4,11-diene-4-carboxylate structure
|
Common Name | methyl 7-ethyl-3-methyl-2,8-dioxo-9-oxa-3-azabicyclo[4.4.0]deca-4,11-diene-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 43083-91-6 | Molecular Weight | 265.26200 | |
| Density | 1.3g/cm3 | Boiling Point | 544.2ºC at 760 mmHg | |
| Molecular Formula | C13H15NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.9ºC | |
| Name | methyl 4-ethyl-7-methyl-3,8-dioxo-1,4-dihydropyrano[3,4-c]pyridine-6-carboxylate |
|---|
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 544.2ºC at 760 mmHg |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26200 |
| Flash Point | 282.9ºC |
| Exact Mass | 265.09500 |
| PSA | 74.60000 |
| LogP | 0.72230 |
| Index of Refraction | 1.554 |
| InChIKey | TXBFRLUFGXWBOP-UHFFFAOYSA-N |
| SMILES | CCC1C(=O)OCc2c1cc(C(=O)OC)n(C)c2=O |
|
~%
methyl 7-ethyl-... CAS#:43083-91-6 |
| Literature: Plattner; Gless; Cooper; Rapoport The Journal of organic chemistry, 1974 , vol. 39, # 3 p. 303 - 311 |