1H-Pyrano[3,4-c]pyridine-3,8(4H,7H)-dione,5-bromo-4-ethyl-4-hydroxy-7-methyl-6-phenyl- structure
|
Common Name | 1H-Pyrano[3,4-c]pyridine-3,8(4H,7H)-dione,5-bromo-4-ethyl-4-hydroxy-7-methyl-6-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 43083-93-8 | Molecular Weight | 378.21700 | |
| Density | 1.59g/cm3 | Boiling Point | 586.9ºC at 760 mmHg | |
| Molecular Formula | C17H16BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.8ºC | |
| Name | 5-bromo-4-ethyl-4-hydroxy-7-methyl-6-phenyl-1H-pyrano[3,4-c]pyridine-3,8-dione |
|---|
| Density | 1.59g/cm3 |
|---|---|
| Boiling Point | 586.9ºC at 760 mmHg |
| Molecular Formula | C17H16BrNO4 |
| Molecular Weight | 378.21700 |
| Flash Point | 308.8ºC |
| Exact Mass | 377.02600 |
| PSA | 68.53000 |
| LogP | 2.46920 |
| Index of Refraction | 1.662 |
| InChIKey | IFPJMORSZTYHSE-UHFFFAOYSA-N |
| SMILES | CCC1(O)C(=O)OCc2c1c(Br)c(-c1ccccc1)n(C)c2=O |
|
~%
1H-Pyrano[3,4-c... CAS#:43083-93-8 |
| Literature: Plattner; Gless; Cooper; Rapoport The Journal of organic chemistry, 1974 , vol. 39, # 3 p. 303 - 311 |
|
~%
1H-Pyrano[3,4-c... CAS#:43083-93-8 |
| Literature: Plattner; Gless; Cooper; Rapoport The Journal of organic chemistry, 1974 , vol. 39, # 3 p. 303 - 311 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |