N-[4,5-bis(4-methylanilino)-9,10-dioxoanthracen-1-yl]benzamide structure
|
Common Name | N-[4,5-bis(4-methylanilino)-9,10-dioxoanthracen-1-yl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 43095-70-1 | Molecular Weight | 537.60700 | |
| Density | 1.335g/cm3 | Boiling Point | 692.5ºC at 760 mmHg | |
| Molecular Formula | C35H27N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176ºC | |
| Name | N-[4,5-bis(4-methylanilino)-9,10-dioxoanthracen-1-yl]benzamide |
|---|
| Density | 1.335g/cm3 |
|---|---|
| Boiling Point | 692.5ºC at 760 mmHg |
| Molecular Formula | C35H27N3O3 |
| Molecular Weight | 537.60700 |
| Flash Point | 176ºC |
| Exact Mass | 537.20500 |
| PSA | 90.79000 |
| LogP | 8.34830 |
| Index of Refraction | 1.735 |
| InChIKey | PHESYJSKVFUDNV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Nc2cccc3c2C(=O)c2c(Nc4ccc(C)cc4)ccc(NC(=O)c4ccccc4)c2C3=O)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |