7H-Furo[3,2-g][1]benzopyran-7-one, 4-(chloromethyl)-9-methoxy- structure
|
Common Name | 7H-Furo[3,2-g][1]benzopyran-7-one, 4-(chloromethyl)-9-methoxy- | ||
|---|---|---|---|---|
| CAS Number | 43111-03-1 | Molecular Weight | 264.66100 | |
| Density | 1.425g/cm3 | Boiling Point | 478.5ºC at 760 mmHg | |
| Molecular Formula | C13H9ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.2ºC | |
| Name | 4-(chloromethyl)-9-methoxyfuro[3,2-g]chromen-7-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.425g/cm3 |
|---|---|
| Boiling Point | 478.5ºC at 760 mmHg |
| Molecular Formula | C13H9ClO4 |
| Molecular Weight | 264.66100 |
| Flash Point | 243.2ºC |
| Exact Mass | 264.01900 |
| PSA | 52.58000 |
| LogP | 3.28660 |
| Index of Refraction | 1.633 |
| InChIKey | NROGXMCPDLBWJB-UHFFFAOYSA-N |
| SMILES | COc1c2occc2c(CCl)c2ccc(=O)oc12 |
|
~75%
7H-Furo[3,2-g][... CAS#:43111-03-1 |
| Literature: Adam, Waldemar; Arnold, Markus A.; Grimm, Guenther N.; Saha-Moeller, Chantu R.; Dall'Acqua, Francesco; Miolo, Gorgia; Vedaldi, Daniela Photochemistry and Photobiology, 1998 , vol. 68, # 4 p. 511 - 518 |
|
~79%
7H-Furo[3,2-g][... CAS#:43111-03-1 |
| Literature: Zhang, Bang-Le; Fan, Cheng-Qi; Dong, Lei; Wang, Fang-Dao; Yue, Jian-Min European Journal of Medicinal Chemistry, 2010 , vol. 45, # 11 p. 5258 - 5264 |
| 4-(chloromethyl)-9-methoxy-7H-furo[3,2-g]chromen-7-one |
| 4-chloromethylxanthotoxin |
| 4-chloromethyl-9-methoxypsoralen |
| 4-chloromethyl-9-methoxy-furo[3,2-g]chromen-7-one |
| 5-Chlormethyl-8-methoxypsoralen |
| 4-(chloromethyl)-9-methoxypyrano[5,6-f][1]benzoxol-7-one |
| 5-chloromethyl-8-methoxypsoralen |