ethyl 4-[(5-amino-6-cyano-pyrazin-2-yl)methyl-methyl-amino]benzoate structure
|
Common Name | ethyl 4-[(5-amino-6-cyano-pyrazin-2-yl)methyl-methyl-amino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 43111-45-1 | Molecular Weight | 311.33800 | |
| Density | 1.29g/cm3 | Boiling Point | 550.6ºC at 760 mmHg | |
| Molecular Formula | C16H17N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286.8ºC | |
| Name | ethyl 4-[(5-amino-6-cyanopyrazin-2-yl)methyl-methylamino]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 550.6ºC at 760 mmHg |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.33800 |
| Flash Point | 286.8ºC |
| Exact Mass | 311.13800 |
| PSA | 105.13000 |
| LogP | 2.32478 |
| Index of Refraction | 1.618 |
| InChIKey | JSMYEARCFNTPMN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(N(C)Cc2cnc(N)c(C#N)n2)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ETHYL 4-[(5-AMINO-6-CYANO-PYRAZIN-2-YL)METHYL-METHYL-AMINO]BENZOATE |
| 2-Amino-3-cyano-5-[[p-ethoxycarbonyl-N-methylanilino]methylpyrazine |
| 4-[(5-amino-6-cyano-pyrazin-2-ylmethyl)-methyl-amino]-benzoic acid ethyl ester |
| Ethyl 4-[[(5-amino-6-cyano-2-pyrazinyl)methyl](methyl)amino]benzoate |