ethyl 2-(2,2,3,3,4,4,4-heptafluorobutanimidoyloxy)acetate structure
|
Common Name | ethyl 2-(2,2,3,3,4,4,4-heptafluorobutanimidoyloxy)acetate | ||
|---|---|---|---|---|
| CAS Number | 4314-33-4 | Molecular Weight | 299.14300 | |
| Density | 1.46g/cm3 | Boiling Point | 164.6ºC at 760 mmHg | |
| Molecular Formula | C8H8F7NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 53.4ºC | |
| Name | 2,2,3,3,4,4,4-Heptafluor-buttersaeure-decylester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 164.6ºC at 760 mmHg |
| Molecular Formula | C8H8F7NO3 |
| Molecular Weight | 299.14300 |
| Flash Point | 53.4ºC |
| Exact Mass | 299.03900 |
| PSA | 59.38000 |
| LogP | 2.47600 |
| Index of Refraction | 1.363 |
| InChIKey | UTKCLYLLDFWDFY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COC(=N)C(F)(F)C(F)(F)C(F)(F)F |
| HS Code | 2925290090 |
|---|
|
~%
ethyl 2-(2,2,3,... CAS#:4314-33-4 |
| Literature: Brown,H.C.; Wetzel,C.R. Journal of Organic Chemistry, 1965 , vol. 30, p. 3729 - 3733 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| DECYL HEPTAFLUOROBUTANOATE |
| 1-Heptafluorobutyryloxydecane |