Butanimidamide,2,2,3,3,4,4,4-heptafluoro-N-hydroxy- structure
|
Common Name | Butanimidamide,2,2,3,3,4,4,4-heptafluoro-N-hydroxy- | ||
|---|---|---|---|---|
| CAS Number | 4314-37-8 | Molecular Weight | 228.068 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 136.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C4H3F7N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 36.4±30.1 °C | |
| Name | ethyl 2-acetylnonanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 136.6±50.0 °C at 760 mmHg |
| Molecular Formula | C4H3F7N2O |
| Molecular Weight | 228.068 |
| Flash Point | 36.4±30.1 °C |
| Exact Mass | 228.013367 |
| PSA | 56.11000 |
| LogP | 3.62 |
| Vapour Pressure | 3.1±0.5 mmHg at 25°C |
| Index of Refraction | 1.337 |
| InChIKey | PKJHWGYUOCAZRL-UHFFFAOYSA-N |
| SMILES | NC(=NO)C(F)(F)C(F)(F)C(F)(F)F |
|
~%
Butanimidamide,... CAS#:4314-37-8 |
| Literature: Brown,H.C.; Wetzel,C.R. Journal of Organic Chemistry, 1965 , vol. 30, p. 3734 - 3738 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| Butanimidamide, 2,2,3,3,4,4,4-heptafluoro-N'-hydroxy- |
| 2,2,3,3,4,4,4-Heptafluoro-N'-hydroxybutanimidamide |
| Benzenemethanol,a-(heptafluoropropyl)-a-phenyl-(9CI) |
| 2,2,3,3,4,4,4-heptafluoro-1,1-diphenyl-butan-1-ol |
| 2,2,3,3,4,4,4-Heptafluor-buttersaeureamidoxim |
| 2,2,3,3,4,4,4-heptafluoro-N-hydroxy-butyramidine |
| 2,2,3,3,4,4,4-Heptafluor-1,1-diphenyl-butan-1-ol |