3-(1,1,2,2,3,3,3-heptafluoropropyl)-2H-1,2,4-oxadiazol-5-one
Modify Date: 2025-09-20 07:56:23
3-(1,1,2,2,3,3,3-heptafluoropropyl)-2H-1,2,4-oxadiazol-5-one structure
|
Common Name | 3-(1,1,2,2,3,3,3-heptafluoropropyl)-2H-1,2,4-oxadiazol-5-one | ||
|---|---|---|---|---|
| CAS Number | 4314-49-2 | Molecular Weight | 254.06200 | |
| Density | 1.89g/cm3 | Boiling Point | 93.5ºC at 760 mmHg | |
| Molecular Formula | C5HF7N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 10.4ºC | |
| Name | 3-(1,1,2,2,3,3,3-heptafluoropropyl)-2H-1,2,4-oxadiazol-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.89g/cm3 |
|---|---|
| Boiling Point | 93.5ºC at 760 mmHg |
| Molecular Formula | C5HF7N2O2 |
| Molecular Weight | 254.06200 |
| Flash Point | 10.4ºC |
| Exact Mass | 253.99300 |
| PSA | 58.89000 |
| LogP | 1.65230 |
| Index of Refraction | 1.393 |
| InChIKey | MZLYKMPRNWAFSI-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(C(F)(F)C(F)(F)C(F)(F)F)no1 |
| HS Code | 2934999090 |
|---|
|
~%
3-(1,1,2,2,3,3,... CAS#:4314-49-2 |
| Literature: Brown,H.C.; Wetzel,C.R. Journal of Organic Chemistry, 1965 , vol. 30, p. 3734 - 3738 |
![[(1-amino-2,2,3,3,4,4,4-heptafluoro-butylidene)amino] chloroformate structure](https://image.chemsrc.com/caspic/149/4368-74-5.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| HMS3092I19 |
| 3-<1,1,2,2,3,3,3-Heptafluor-propyl>-4H-1,2,4-oxadiazolin-5-on |