5-methyl-2-nitrobenzamide
5-methyl-2-nitrobenzamide structure
|
Common Name | 5-methyl-2-nitrobenzamide | ||
|---|---|---|---|---|
| CAS Number | 4315-12-2 | Molecular Weight | 180.16100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-methyl-2-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H8N2O3 |
|---|---|
| Molecular Weight | 180.16100 |
| Exact Mass | 180.05300 |
| PSA | 88.91000 |
| LogP | 2.22560 |
| InChIKey | KNJDDEARUYAGMA-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])c(C(N)=O)c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2924299090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:40545-33-3
CAS#:5925-93-9
CAS#:64113-86-6This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Nitro-5-methyl-benzamid |
| 2-Carbamoyl-4-methyl-nitrobenzol |
| 5-Methyl-2-nitro-benzoesaeure-amid |
| 5-methyl-2-nitro-benzoic acid amide |
| 5-Methyl-2-Nitrobenzamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 4315-12-2? |
| A: Chinese name of 4315-12-2 is 4315-12-2. |
| Q: What is the InChIKey of 5-methyl-2-nitrobenzamide? |
| A: InChIKey of 5-methyl-2-nitrobenzamide is KNJDDEARUYAGMA-UHFFFAOYSA-N. |
| Q: What are the downstream products of 5-methyl-2-nitrobenzamide? |
| A: Related downstream products(CAS) of 5-methyl-2-nitrobenzamide: 40545-33-3;5925-93-9;64113-86-6. |
| Q: What is the CAS number of 5-methyl-2-nitrobenzamide? |
| A: CAS number of 5-methyl-2-nitrobenzamide is 4315-12-2. |
| Q: What is the polar surface area (PSA) of 5-methyl-2-nitrobenzamide? |
| A: Polar surface area (PSA) of 5-methyl-2-nitrobenzamide is 88.91000. |
| Q: What English synonyms does 5-methyl-2-nitrobenzamide have? |
| A: English synonyms of 5-methyl-2-nitrobenzamide: 2-Nitro-5-methyl-benzamid, 2-Carbamoyl-4-methyl-nitrobenzol, 5-Methyl-2-nitro-benzoesaeure-amid, 5-methyl-2-nitro-benzoic acid amide, 5-Methyl-2-Nitrobenzamide. |
| Q: What is the English name of 5-methyl-2-nitrobenzamide? |
| A: The English name of 5-methyl-2-nitrobenzamide is 5-methyl-2-nitrobenzamide. |
| Q: What is the LogP of 5-methyl-2-nitrobenzamide? |
| A: LogP of 5-methyl-2-nitrobenzamide is 2.22560. |
| Q: What is the molecular weight of 5-methyl-2-nitrobenzamide? |
| A: Molecular weight of 5-methyl-2-nitrobenzamide is 180.16100. |
| Q: What is the molecular formula of 5-methyl-2-nitrobenzamide? |
| A: Molecular formula of 5-methyl-2-nitrobenzamide is C8H8N2O3. |